About 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol
1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol (PubChem CID 130913754) has the molecular formula C8H12ClN3OS
and a molecular weight of 233.72 g/mol. Its IUPAC name is 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol |
| PubChem CID | 130913754 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol |
| SMILES | OC1(CCNc2nsnc2Cl)CCC1 |
| InChI | InChI=1S/C8H12ClN3OS/c9-6-7(12-14-11-6)10-5-4-8(13)2-1-3-8/h13H,1-5H2,(H,10,12) |
| InChIKey | VGRJKVBWKMJYNQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol?
The IUPAC name of 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol (CID 130913754) is 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol.
What is the SMILES notation for 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol?
The canonical SMILES for 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol is OC1(CCNc2nsnc2Cl)CCC1.
What is the InChIKey of 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol?
The InChIKey is VGRJKVBWKMJYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3OS/c9-6-7(12-14-11-6)10-5-4-8(13)2-1-3-8/h13H,1-5H2,(H,10,12).
What are the key properties of 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol?
1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol has a molecular weight of 233.72 g/mol, XLogP of 1.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethyl]cyclobutan-1-ol is sourced from PubChem (CID 130913754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).