C9H13NO3 — CID 130913931
(4aS,9aR)-2,3,4,4a,6,7,9,9a-octahydropyrano[2,3-b]azepine-5,8-dione (PubChem CID 130913931) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (4aS,9aR)-2,3,4,4a,6,7,9,9a-octahydropyrano[2,3-b]azepine-5,8-dione.
| Compound Name | (4aS,9aR)-2,3,4,4a,6,7,9,9a-octahydropyrano[2,3-b]azepine-5,8-dione |
|---|---|
| PubChem CID | 130913931 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (4aS,9aR)-2,3,4,4a,6,7,9,9a-octahydropyrano[2,3-b]azepine-5,8-dione |
| SMILES | O=C1CCC(=O)[C@H]2CCCO[C@H]2N1 |
| InChI | InChI=1S/C9H13NO3/c11-7-3-4-8(12)10-9-6(7)2-1-5-13-9/h6,9H,1-5H2,(H,10,12)/t6-,9-/m1/s1 |
| InChIKey | VIVTUZYFBDEKST-HZGVNTEJSA-N |
| XLogP | 0.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |