About 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol
2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol (PubChem CID 130914635) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol |
| PubChem CID | 130914635 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol |
| SMILES | CN1CCCN=C1NC(CO)CO |
| InChI | InChI=1S/C8H17N3O2/c1-11-4-2-3-9-8(11)10-7(5-12)6-13/h7,12-13H,2-6H2,1H3,(H,9,10) |
| InChIKey | MKBVRAJOBGWYEW-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol?
The IUPAC name of 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol (CID 130914635) is 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol.
What is the SMILES notation for 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol?
The canonical SMILES for 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol is CN1CCCN=C1NC(CO)CO.
What is the InChIKey of 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol?
The InChIKey is MKBVRAJOBGWYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-11-4-2-3-9-8(11)10-7(5-12)6-13/h7,12-13H,2-6H2,1H3,(H,9,10).
What are the key properties of 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol?
2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol has a molecular weight of 187.24 g/mol, XLogP of -1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)amino]propane-1,3-diol is sourced from PubChem (CID 130914635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).