About 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole
5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole (PubChem CID 130918020) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole |
| PubChem CID | 130918020 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole |
| SMILES | CC1CCN(Cc2cnc[nH]2)C1C |
| InChI | InChI=1S/C10H17N3/c1-8-3-4-13(9(8)2)6-10-5-11-7-12-10/h5,7-9H,3-4,6H2,1-2H3,(H,11,12) |
| InChIKey | QYVWUQYCDHXENL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole?
The IUPAC name of 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole (CID 130918020) is 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole?
The canonical SMILES for 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole is CC1CCN(Cc2cnc[nH]2)C1C.
What is the InChIKey of 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole?
The InChIKey is QYVWUQYCDHXENL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-8-3-4-13(9(8)2)6-10-5-11-7-12-10/h5,7-9H,3-4,6H2,1-2H3,(H,11,12).
What are the key properties of 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole?
5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole has a molecular weight of 179.27 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dimethylpyrrolidin-1-yl)methyl]-1H-imidazole is sourced from PubChem (CID 130918020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).