C11H16O — CID 130918583
(1S,2R,4S,6S,7R)-4-methyltricyclo[5.2.1.02,6]decan-3-one (PubChem CID 130918583) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,2R,4S,6S,7R)-4-methyltricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2R,4S,6S,7R)-4-methyltricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 130918583 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,2R,4S,6S,7R)-4-methyltricyclo[5.2.1.02,6]decan-3-one |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C1=O |
| InChI | InChI=1S/C11H16O/c1-6-4-9-7-2-3-8(5-7)10(9)11(6)12/h6-10H,2-5H2,1H3/t6-,7+,8-,9-,10+/m0/s1 |
| InChIKey | WQQOJYNURMTIRJ-CVPUBMOQSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |