C12H20O — CID 130918738
(1S)-1-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]ethanol (PubChem CID 130918738) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1S)-1-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]ethanol.
| Compound Name | (1S)-1-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]ethanol |
|---|---|
| PubChem CID | 130918738 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1S)-1-[(2S,5R)-2,5-bis(ethenyl)-1-methylcyclopentyl]ethanol |
| SMILES | C=C[C@@H]1CC[C@H](C=C)C1(C)[C@H](C)O |
| InChI | InChI=1S/C12H20O/c1-5-10-7-8-11(6-2)12(10,4)9(3)13/h5-6,9-11,13H,1-2,7-8H2,3-4H3/t9-,10-,11+,12?/m0/s1 |
| InChIKey | WCSNQXFVKDXOHY-WSMDXJOWSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|