About 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione
5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione (PubChem CID 13091999) has the molecular formula C10H9NO4
and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione |
| PubChem CID | 13091999 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione |
| SMILES | COc1ccccc1C1OC(=O)NC1=O |
| InChI | InChI=1S/C10H9NO4/c1-14-7-5-3-2-4-6(7)8-9(12)11-10(13)15-8/h2-5,8H,1H3,(H,11,12,13) |
| InChIKey | ULAQKPXNVOJZJW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione (CID 13091999) is 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione is COc1ccccc1C1OC(=O)NC1=O.
What is the InChIKey of 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione?
The InChIKey is ULAQKPXNVOJZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c1-14-7-5-3-2-4-6(7)8-9(12)11-10(13)15-8/h2-5,8H,1H3,(H,11,12,13).
What are the key properties of 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione?
5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione has a molecular weight of 207.19 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 13091999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).