C8H2F6O — CID 130920299
2,2-difluoro-1-(2,3,4,5-tetrafluorophenyl)ethanone (PubChem CID 130920299) has the molecular formula C8H2F6O and a molecular weight of 228.09 g/mol. Its IUPAC name is 2,2-difluoro-1-(2,3,4,5-tetrafluorophenyl)ethanone.
| Compound Name | 2,2-difluoro-1-(2,3,4,5-tetrafluorophenyl)ethanone |
|---|---|
| PubChem CID | 130920299 |
| Molecular Formula | C8H2F6O |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2,2-difluoro-1-(2,3,4,5-tetrafluorophenyl)ethanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)C(F)F |
| InChI | InChI=1S/C8H2F6O/c9-3-1-2(7(15)8(13)14)4(10)6(12)5(3)11/h1,8H |
| InChIKey | IBMNAATYSIJOSY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|