C10H14N2O — CID 130920640
N-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]but-2-yn-1-amine (PubChem CID 130920640) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is N-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]but-2-yn-1-amine.
| Compound Name | N-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 130920640 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]but-2-yn-1-amine |
| SMILES | CC#CCN(C)Cc1cc(C)no1 |
| InChI | InChI=1S/C10H14N2O/c1-4-5-6-12(3)8-10-7-9(2)11-13-10/h7H,6,8H2,1-3H3 |
| InChIKey | NOZZBTATZXQIJU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|