C10H14ClN3O — CID 130921256
1-(6-chloro-2-methylpyrimidin-4-yl)-5-methylpyrrolidin-3-ol (PubChem CID 130921256) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is 1-(6-chloro-2-methylpyrimidin-4-yl)-5-methylpyrrolidin-3-ol.
| Compound Name | 1-(6-chloro-2-methylpyrimidin-4-yl)-5-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 130921256 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(6-chloro-2-methylpyrimidin-4-yl)-5-methylpyrrolidin-3-ol |
| SMILES | Cc1nc(Cl)cc(N2CC(O)CC2C)n1 |
| InChI | InChI=1S/C10H14ClN3O/c1-6-3-8(15)5-14(6)10-4-9(11)12-7(2)13-10/h4,6,8,15H,3,5H2,1-2H3 |
| InChIKey | GLVPDUNUEVTTTR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |