About 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide
5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 130921739) has the molecular formula C7H8BrFN2OS
and a molecular weight of 267.12 g/mol. Its IUPAC name is 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 130921739 |
| Molecular Formula | C7H8BrFN2OS |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(CF)NC(=O)c1ncc(Br)s1 |
| InChI | InChI=1S/C7H8BrFN2OS/c1-4(2-9)11-6(12)7-10-3-5(8)13-7/h3-4H,2H2,1H3,(H,11,12) |
| InChIKey | CBNQLAYFOJOIOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide (CID 130921739) is 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide is CC(CF)NC(=O)c1ncc(Br)s1.
What is the InChIKey of 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide?
The InChIKey is CBNQLAYFOJOIOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrFN2OS/c1-4(2-9)11-6(12)7-10-3-5(8)13-7/h3-4H,2H2,1H3,(H,11,12).
What are the key properties of 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide?
5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide has a molecular weight of 267.12 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1-fluoropropan-2-yl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130921739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).