C8H14N2O — CID 13092247
7-methyl-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrimidin-6-one (PubChem CID 13092247) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 7-methyl-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrimidin-6-one.
| Compound Name | 7-methyl-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 13092247 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 7-methyl-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrimidin-6-one |
| SMILES | CC1CC2NCCCN2C1=O |
| InChI | InChI=1S/C8H14N2O/c1-6-5-7-9-3-2-4-10(7)8(6)11/h6-7,9H,2-5H2,1H3 |
| InChIKey | ZQEYJNMCPHMSNO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |