About methyl 6-cyano-2,3-diiodobenzoate
methyl 6-cyano-2,3-diiodobenzoate (PubChem CID 130923706) has the molecular formula C9H5I2NO2
and a molecular weight of 412.95 g/mol. Its IUPAC name is methyl 6-cyano-2,3-diiodobenzoate.
Molecular Properties
| Compound Name | methyl 6-cyano-2,3-diiodobenzoate |
| PubChem CID | 130923706 |
| Molecular Formula | C9H5I2NO2 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.84 |
| IUPAC Name | methyl 6-cyano-2,3-diiodobenzoate |
| SMILES | COC(=O)c1c(C#N)ccc(I)c1I |
| InChI | InChI=1S/C9H5I2NO2/c1-14-9(13)7-5(4-12)2-3-6(10)8(7)11/h2-3H,1H3 |
| InChIKey | OIWBZVDZIAVICT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-cyano-2,3-diiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-cyano-2,3-diiodobenzoate?
The IUPAC name of methyl 6-cyano-2,3-diiodobenzoate (CID 130923706) is methyl 6-cyano-2,3-diiodobenzoate.
What is the SMILES notation for methyl 6-cyano-2,3-diiodobenzoate?
The canonical SMILES for methyl 6-cyano-2,3-diiodobenzoate is COC(=O)c1c(C#N)ccc(I)c1I.
What is the InChIKey of methyl 6-cyano-2,3-diiodobenzoate?
The InChIKey is OIWBZVDZIAVICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5I2NO2/c1-14-9(13)7-5(4-12)2-3-6(10)8(7)11/h2-3H,1H3.
What are the key properties of methyl 6-cyano-2,3-diiodobenzoate?
methyl 6-cyano-2,3-diiodobenzoate has a molecular weight of 412.95 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-cyano-2,3-diiodobenzoate is sourced from PubChem (CID 130923706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).