About tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate
tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 130924314) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate |
| PubChem CID | 130924314 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO3/c1-5-8-6-9(13)7-12(8)10(14)15-11(2,3)4/h5,8-9,13H,1,6-7H2,2-4H3/t8-,9-/m1/s1 |
| InChIKey | NTRJYMDWSTVAKN-RKDXNWHRSA-N |
| XLogP | 1.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate (CID 130924314) is tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate is C=C[C@@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate?
The InChIKey is NTRJYMDWSTVAKN-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H19NO3/c1-5-8-6-9(13)7-12(8)10(14)15-11(2,3)4/h5,8-9,13H,1,6-7H2,2-4H3/t8-,9-/m1/s1.
What are the key properties of tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate?
tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4R)-2-ethenyl-4-hydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 130924314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).