C10H10ClNOS — CID 13092656
5-(4-chlorophenyl)-4-methyl-1,3-thiazolidin-2-one (PubChem CID 13092656) has the molecular formula C10H10ClNOS and a molecular weight of 227.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-1,3-thiazolidin-2-one.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 13092656 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-1,3-thiazolidin-2-one |
| SMILES | CC1NC(=O)SC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10ClNOS/c1-6-9(14-10(13)12-6)7-2-4-8(11)5-3-7/h2-6,9H,1H3,(H,12,13) |
| InChIKey | IPCDQNZFHKSICG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|