C7H11BrO2 — CID 130927340
(1R,2S,3S)-3-bromo-1-ethenylcyclopentane-1,2-diol (PubChem CID 130927340) has the molecular formula C7H11BrO2 and a molecular weight of 207.07 g/mol. Its IUPAC name is (1R,2S,3S)-3-bromo-1-ethenylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3S)-3-bromo-1-ethenylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 130927340 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (1R,2S,3S)-3-bromo-1-ethenylcyclopentane-1,2-diol |
| SMILES | C=C[C@]1(O)CC[C@H](Br)[C@H]1O |
| InChI | InChI=1S/C7H11BrO2/c1-2-7(10)4-3-5(8)6(7)9/h2,5-6,9-10H,1,3-4H2/t5-,6+,7-/m0/s1 |
| InChIKey | FUZDRYZYNIKSAX-XVMARJQXSA-N |
| XLogP | 0.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|