About (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol
(5S)-6,10,10-trimethylspiro[4.5]decan-3-ol (PubChem CID 130927419) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol.
Molecular Properties
| Compound Name | (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol |
| PubChem CID | 130927419 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol |
| SMILES | CC1CCCC(C)(C)[C@]12CCC(O)C2 |
| InChI | InChI=1S/C13H24O/c1-10-5-4-7-12(2,3)13(10)8-6-11(14)9-13/h10-11,14H,4-9H2,1-3H3/t10?,11?,13-/m0/s1 |
| InChIKey | UCYYIHLOXDKEIL-XIVSLSHWSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol?
The IUPAC name of (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol (CID 130927419) is (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol.
What is the SMILES notation for (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol?
The canonical SMILES for (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol is CC1CCCC(C)(C)[C@]12CCC(O)C2.
What is the InChIKey of (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol?
The InChIKey is UCYYIHLOXDKEIL-XIVSLSHWSA-N. The full InChI is InChI=1S/C13H24O/c1-10-5-4-7-12(2,3)13(10)8-6-11(14)9-13/h10-11,14H,4-9H2,1-3H3/t10?,11?,13-/m0/s1.
What are the key properties of (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol?
(5S)-6,10,10-trimethylspiro[4.5]decan-3-ol has a molecular weight of 196.33 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6,10,10-trimethylspiro[4.5]decan-3-ol is sourced from PubChem (CID 130927419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).