C8H12N2O3 — CID 130927432
(2S,3R,4R)-2-(1-methylimidazol-4-yl)oxolane-3,4-diol (PubChem CID 130927432) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is (2S,3R,4R)-2-(1-methylimidazol-4-yl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4R)-2-(1-methylimidazol-4-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 130927432 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (2S,3R,4R)-2-(1-methylimidazol-4-yl)oxolane-3,4-diol |
| SMILES | Cn1cnc([C@@H]2OC[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C8H12N2O3/c1-10-2-5(9-4-10)8-7(12)6(11)3-13-8/h2,4,6-8,11-12H,3H2,1H3/t6-,7-,8+/m1/s1 |
| InChIKey | CNDBUSUZRHQFKJ-PRJMDXOYSA-N |
| XLogP | -0.79 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |