C8H16OS2 — CID 130927448
(2S)-1-(2-methyl-1,3-dithian-2-yl)propan-2-ol (PubChem CID 130927448) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is (2S)-1-(2-methyl-1,3-dithian-2-yl)propan-2-ol.
| Compound Name | (2S)-1-(2-methyl-1,3-dithian-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 130927448 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2S)-1-(2-methyl-1,3-dithian-2-yl)propan-2-ol |
| SMILES | C[C@H](O)CC1(C)SCCCS1 |
| InChI | InChI=1S/C8H16OS2/c1-7(9)6-8(2)10-4-3-5-11-8/h7,9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | YGYXMZPZVVVERY-ZETCQYMHSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |