About 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole
3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole (PubChem CID 130927635) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole.
Analyze 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole?
The IUPAC name of 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole (CID 130927635) is 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole.
What is the SMILES notation for 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole?
The canonical SMILES for 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole is CC1(Cc2cnsn2)CCCN1.
What is the InChIKey of 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole?
The InChIKey is YTGZKGAJMCMFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-8(3-2-4-9-8)5-7-6-10-12-11-7/h6,9H,2-5H2,1H3.
What are the key properties of 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole?
3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole has a molecular weight of 183.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylpyrrolidin-2-yl)methyl]-1,2,5-thiadiazole is sourced from PubChem (CID 130927635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).