3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid

C6H5ClFNO2S — CID 130927768

IUPAC3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid
SMILESO=C(O)C(F)Cc1ncc(Cl)s1
InChIInChI=1S/C6H5ClFNO2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1H2,(H,10,11)
InChIKeyGEKGKUASTPXYDC-UHFFFAOYSA-N
MW209.63 g/mol
LogP1.76
Rot. Bonds3

About 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid

3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid (PubChem CID 130927768) has the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid.

Molecular Properties

Compound Name3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid
PubChem CID130927768
Molecular FormulaC6H5ClFNO2S
Molecular Weight209.63 g/mol
Exact Mass208.97
IUPAC Name3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid
SMILESO=C(O)C(F)Cc1ncc(Cl)s1
InChIInChI=1S/C6H5ClFNO2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1H2,(H,10,11)
InChIKeyGEKGKUASTPXYDC-UHFFFAOYSA-N
XLogP1.76
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.63
LogP ≤ 51.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid?
The IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid (CID 130927768) is 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid.
What is the SMILES notation for 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid?
The canonical SMILES for 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid is O=C(O)C(F)Cc1ncc(Cl)s1.
What is the InChIKey of 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid?
The InChIKey is GEKGKUASTPXYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClFNO2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1H2,(H,10,11).
What are the key properties of 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid?
3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid has a molecular weight of 209.63 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-thiazol-2-yl)-2-fluoropropanoic acid is sourced from PubChem (CID 130927768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).