About [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol
[(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol (PubChem CID 130928124) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol.
Molecular Properties
| Compound Name | [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol |
| PubChem CID | 130928124 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol |
| SMILES | OC[C@@H]1C[C@]12CC21CC1 |
| InChI | InChI=1S/C8H12O/c9-4-6-3-8(6)5-7(8)1-2-7/h6,9H,1-5H2/t6-,8-/m0/s1 |
| InChIKey | LTKJWYVADOMAGA-XPUUQOCRSA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol?
The IUPAC name of [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol (CID 130928124) is [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol.
What is the SMILES notation for [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol?
The canonical SMILES for [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol is OC[C@@H]1C[C@]12CC21CC1.
What is the InChIKey of [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol?
The InChIKey is LTKJWYVADOMAGA-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H12O/c9-4-6-3-8(6)5-7(8)1-2-7/h6,9H,1-5H2/t6-,8-/m0/s1.
What are the key properties of [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol?
[(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol has a molecular weight of 124.18 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5R)-dispiro[2.0.24.13]heptan-5-yl]methanol is sourced from PubChem (CID 130928124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).