C10H16O6 — CID 13092881
1,2,2-trimethylcyclopentane-1,3-dicarboperoxoic acid (PubChem CID 13092881) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1,2,2-trimethylcyclopentane-1,3-dicarboperoxoic acid.
| Compound Name | 1,2,2-trimethylcyclopentane-1,3-dicarboperoxoic acid |
|---|---|
| PubChem CID | 13092881 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1,2,2-trimethylcyclopentane-1,3-dicarboperoxoic acid |
| SMILES | CC1(C(=O)OO)CCC(C(=O)OO)C1(C)C |
| InChI | InChI=1S/C10H16O6/c1-9(2)6(7(11)15-13)4-5-10(9,3)8(12)16-14/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | KABIUTSICXJJJV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|