About 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione
3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 13093448) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione |
| PubChem CID | 13093448 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C)C(CCO)C1=O |
| InChI | InChI=1S/C8H14N2O3/c1-9-5-7(12)10(2)6(3-4-11)8(9)13/h6,11H,3-5H2,1-2H3 |
| InChIKey | MHRGFGAHMGDAPC-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione?
The IUPAC name of 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione (CID 13093448) is 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione.
What is the SMILES notation for 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione?
The canonical SMILES for 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione is CN1CC(=O)N(C)C(CCO)C1=O.
What is the InChIKey of 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione?
The InChIKey is MHRGFGAHMGDAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-9-5-7(12)10(2)6(3-4-11)8(9)13/h6,11H,3-5H2,1-2H3.
What are the key properties of 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione?
3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione has a molecular weight of 186.21 g/mol, XLogP of -1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-1,4-dimethylpiperazine-2,5-dione is sourced from PubChem (CID 13093448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).