About (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone
(4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone (PubChem CID 130934480) has the molecular formula C10H14BrN3O
and a molecular weight of 272.15 g/mol. Its IUPAC name is (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone.
Molecular Properties
| Compound Name | (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone |
| PubChem CID | 130934480 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cn[nH]c2)CC1Br |
| InChI | InChI=1S/C10H14BrN3O/c1-10(2)6-14(5-8(10)11)9(15)7-3-12-13-4-7/h3-4,8H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | HOYSONIYXAHFJE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone?
The IUPAC name of (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone (CID 130934480) is (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone.
What is the SMILES notation for (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone?
The canonical SMILES for (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone is CC1(C)CN(C(=O)c2cn[nH]c2)CC1Br.
What is the InChIKey of (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone?
The InChIKey is HOYSONIYXAHFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3O/c1-10(2)6-14(5-8(10)11)9(15)7-3-12-13-4-7/h3-4,8H,5-6H2,1-2H3,(H,12,13).
What are the key properties of (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone?
(4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone has a molecular weight of 272.15 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3,3-dimethylpyrrolidin-1-yl)-(1H-pyrazol-4-yl)methanone is sourced from PubChem (CID 130934480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).