C12H24N2 — CID 130934596
1-(3,3-dimethylcyclobutyl)-5-methylpiperidin-3-amine (PubChem CID 130934596) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclobutyl)-5-methylpiperidin-3-amine.
| Compound Name | 1-(3,3-dimethylcyclobutyl)-5-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 130934596 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(3,3-dimethylcyclobutyl)-5-methylpiperidin-3-amine |
| SMILES | CC1CC(N)CN(C2CC(C)(C)C2)C1 |
| InChI | InChI=1S/C12H24N2/c1-9-4-10(13)8-14(7-9)11-5-12(2,3)6-11/h9-11H,4-8,13H2,1-3H3 |
| InChIKey | TUVRNQZIGBBVSD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |