About 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate
2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate (PubChem CID 13093616) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate |
| PubChem CID | 13093616 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate |
| SMILES | CC(C)COC(=O)c1cc2c(C(=O)CNC(C)(C)C)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C19H26N2O4/c1-11(2)10-25-18(24)14-8-13-12(6-7-15(22)17(13)21-14)16(23)9-20-19(3,4)5/h6-8,11,20-22H,9-10H2,1-5H3 |
| InChIKey | USQLLUPLXZCBRI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate?
The IUPAC name of 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate (CID 13093616) is 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate is CC(C)COC(=O)c1cc2c(C(=O)CNC(C)(C)C)ccc(O)c2[nH]1.
What is the InChIKey of 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate?
The InChIKey is USQLLUPLXZCBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-11(2)10-25-18(24)14-8-13-12(6-7-15(22)17(13)21-14)16(23)9-20-19(3,4)5/h6-8,11,20-22H,9-10H2,1-5H3.
What are the key properties of 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate?
2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate has a molecular weight of 346.43 g/mol, XLogP of 3.26, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[2-(tert-butylamino)acetyl]-7-hydroxy-1H-indole-2-carboxylate is sourced from PubChem (CID 13093616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).