About 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine
1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine (PubChem CID 130937992) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine |
| PubChem CID | 130937992 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NC1CCC(O)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-10-9(11-2)12-7-3-5-8(13)6-4-7/h7-8,13H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | NSFHRHZILKAVFM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine?
The IUPAC name of 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine (CID 130937992) is 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine.
What is the SMILES notation for 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine?
The canonical SMILES for 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine is C/N=C(\NC)NC1CCC(O)CC1.
What is the InChIKey of 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine?
The InChIKey is NSFHRHZILKAVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-10-9(11-2)12-7-3-5-8(13)6-4-7/h7-8,13H,3-6H2,1-2H3,(H2,10,11,12).
What are the key properties of 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine?
1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine has a molecular weight of 185.27 g/mol, XLogP of 0.08, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxycyclohexyl)-2,3-dimethylguanidine is sourced from PubChem (CID 130937992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).