About 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile
3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 13093905) has the molecular formula C14H10Cl2FN3O2S
and a molecular weight of 374.22 g/mol. Its IUPAC name is 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 13093905 |
| Molecular Formula | C14H10Cl2FN3O2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | Cc1cccc(C)c1-n1cc(C#N)c(=O)n(SC(F)(Cl)Cl)c1=O |
| InChI | InChI=1S/C14H10Cl2FN3O2S/c1-8-4-3-5-9(2)11(8)19-7-10(6-18)12(21)20(13(19)22)23-14(15,16)17/h3-5,7H,1-2H3 |
| InChIKey | QGACULLGDHFDDM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 13093905) is 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is Cc1cccc(C)c1-n1cc(C#N)c(=O)n(SC(F)(Cl)Cl)c1=O.
What is the InChIKey of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is QGACULLGDHFDDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2FN3O2S/c1-8-4-3-5-9(2)11(8)19-7-10(6-18)12(21)20(13(19)22)23-14(15,16)17/h3-5,7H,1-2H3.
What are the key properties of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 374.22 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-dimethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 13093905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).