C14H17N5O8S2 — CID 13093969
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxy-3-(2-methylsulfonylphenyl)sulfonylurea (PubChem CID 13093969) has the molecular formula C14H17N5O8S2 and a molecular weight of 447.45 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxy-3-(2-methylsulfonylphenyl)sulfonylurea.
| Compound Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxy-3-(2-methylsulfonylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 13093969 |
| Molecular Formula | C14H17N5O8S2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxy-3-(2-methylsulfonylphenyl)sulfonylurea |
| SMILES | COc1nc(OC)nc(N(OC)C(=O)NS(=O)(=O)c2ccccc2S(C)(=O)=O)n1 |
| InChI | InChI=1S/C14H17N5O8S2/c1-25-12-15-11(16-13(17-12)26-2)19(27-3)14(20)18-29(23,24)10-8-6-5-7-9(10)28(4,21)22/h5-8H,1-4H3,(H,18,20) |
| InChIKey | ABIZNKPTGVUHGM-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|