About 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one
4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one (PubChem CID 130942307) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 130942307 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one |
| SMILES | Cc1nocc1CN1CC(O)CC1=O |
| InChI | InChI=1S/C9H12N2O3/c1-6-7(5-14-10-6)3-11-4-8(12)2-9(11)13/h5,8,12H,2-4H2,1H3 |
| InChIKey | JHWVIMZUINYQAZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one (CID 130942307) is 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one is Cc1nocc1CN1CC(O)CC1=O.
What is the InChIKey of 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one?
The InChIKey is JHWVIMZUINYQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-6-7(5-14-10-6)3-11-4-8(12)2-9(11)13/h5,8,12H,2-4H2,1H3.
What are the key properties of 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one?
4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one has a molecular weight of 196.21 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-[(3-methyl-1,2-oxazol-4-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 130942307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).