C7H13N5O — CID 130942431
1,2-dimethyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]guanidine (PubChem CID 130942431) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 1,2-dimethyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 130942431 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1,2-dimethyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]guanidine |
| SMILES | C/N=C(\NC)NC(C)c1ncon1 |
| InChI | InChI=1S/C7H13N5O/c1-5(6-10-4-13-12-6)11-7(8-2)9-3/h4-5H,1-3H3,(H2,8,9,11) |
| InChIKey | BNPHNBHSPKGVDU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|