C11H15N — CID 13094330
2,6-dimethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 13094330) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2,6-dimethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 13094330 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc2c(c1)CCC(C)N2 |
| InChI | InChI=1S/C11H15N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3,6-7,9,12H,4-5H2,1-2H3 |
| InChIKey | IHEQGRQCHGIUQE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |