About 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol
2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol (PubChem CID 130943414) has the molecular formula C6H6BrF2NO2S
and a molecular weight of 274.09 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol |
| PubChem CID | 130943414 |
| Molecular Formula | C6H6BrF2NO2S |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol |
| SMILES | COc1cc(C(O)C(F)(F)Br)sn1 |
| InChI | InChI=1S/C6H6BrF2NO2S/c1-12-4-2-3(13-10-4)5(11)6(7,8)9/h2,5,11H,1H3 |
| InChIKey | LFLWMCQQGRWLQH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The IUPAC name of 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol (CID 130943414) is 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol.
What is the SMILES notation for 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The canonical SMILES for 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol is COc1cc(C(O)C(F)(F)Br)sn1.
What is the InChIKey of 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The InChIKey is LFLWMCQQGRWLQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrF2NO2S/c1-12-4-2-3(13-10-4)5(11)6(7,8)9/h2,5,11H,1H3.
What are the key properties of 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol has a molecular weight of 274.09 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol is sourced from PubChem (CID 130943414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).