About 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid
2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid (PubChem CID 130943475) has the molecular formula C5H4N2O3S
and a molecular weight of 172.16 g/mol. Its IUPAC name is 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid |
| PubChem CID | 130943475 |
| Molecular Formula | C5H4N2O3S |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid |
| SMILES | O=C(O)C(=O)Cc1cnsn1 |
| InChI | InChI=1S/C5H4N2O3S/c8-4(5(9)10)1-3-2-6-11-7-3/h2H,1H2,(H,9,10) |
| InChIKey | SFRAONOKDLOTIZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid?
The IUPAC name of 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid (CID 130943475) is 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid.
What is the SMILES notation for 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid?
The canonical SMILES for 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid is O=C(O)C(=O)Cc1cnsn1.
What is the InChIKey of 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid?
The InChIKey is SFRAONOKDLOTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3S/c8-4(5(9)10)1-3-2-6-11-7-3/h2H,1H2,(H,9,10).
What are the key properties of 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid?
2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid has a molecular weight of 172.16 g/mol, XLogP of -0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-(1,2,5-thiadiazol-3-yl)propanoic acid is sourced from PubChem (CID 130943475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).