About 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one
4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one (PubChem CID 130944205) has the molecular formula C7H10N4OS
and a molecular weight of 198.25 g/mol. Its IUPAC name is 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one |
| PubChem CID | 130944205 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CNc2ncns2)CN1 |
| InChI | InChI=1S/C7H10N4OS/c12-6-1-5(2-8-6)3-9-7-10-4-11-13-7/h4-5H,1-3H2,(H,8,12)(H,9,10,11) |
| InChIKey | AYFOKXCAEIBZIZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one?
The IUPAC name of 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one (CID 130944205) is 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one?
The canonical SMILES for 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one is O=C1CC(CNc2ncns2)CN1.
What is the InChIKey of 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one?
The InChIKey is AYFOKXCAEIBZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4OS/c12-6-1-5(2-8-6)3-9-7-10-4-11-13-7/h4-5H,1-3H2,(H,8,12)(H,9,10,11).
What are the key properties of 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one?
4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one has a molecular weight of 198.25 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,2,4-thiadiazol-5-ylamino)methyl]pyrrolidin-2-one is sourced from PubChem (CID 130944205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).