About 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone
1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone (PubChem CID 13094732) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone |
| PubChem CID | 13094732 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone |
| SMILES | C=C1CC(C)=C(C)CC1C(C)=O |
| InChI | InChI=1S/C11H16O/c1-7-5-9(3)11(10(4)12)6-8(7)2/h11H,3,5-6H2,1-2,4H3 |
| InChIKey | VQNXYKNCMNFUOO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone?
The IUPAC name of 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone (CID 13094732) is 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone.
What is the SMILES notation for 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone?
The canonical SMILES for 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone is C=C1CC(C)=C(C)CC1C(C)=O.
What is the InChIKey of 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone?
The InChIKey is VQNXYKNCMNFUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-7-5-9(3)11(10(4)12)6-8(7)2/h11H,3,5-6H2,1-2,4H3.
What are the key properties of 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone?
1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone has a molecular weight of 164.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethyl-6-methylidenecyclohex-3-en-1-yl)ethanone is sourced from PubChem (CID 13094732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).