C8H11BrN4O2 — CID 130948425
N-[3-(bromomethyl)oxolan-3-yl]-2H-triazole-4-carboxamide (PubChem CID 130948425) has the molecular formula C8H11BrN4O2 and a molecular weight of 275.11 g/mol. Its IUPAC name is N-[3-(bromomethyl)oxolan-3-yl]-2H-triazole-4-carboxamide.
| Compound Name | N-[3-(bromomethyl)oxolan-3-yl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 130948425 |
| Molecular Formula | C8H11BrN4O2 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | N-[3-(bromomethyl)oxolan-3-yl]-2H-triazole-4-carboxamide |
| SMILES | O=C(NC1(CBr)CCOC1)c1cn[nH]n1 |
| InChI | InChI=1S/C8H11BrN4O2/c9-4-8(1-2-15-5-8)11-7(14)6-3-10-13-12-6/h3H,1-2,4-5H2,(H,11,14)(H,10,12,13) |
| InChIKey | PVMDTJMDECUDGF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|