C8H11ClN2OS — CID 130948894
3-amino-N-(2-chlorothiophen-3-yl)-2-methylpropanamide (PubChem CID 130948894) has the molecular formula C8H11ClN2OS and a molecular weight of 218.71 g/mol. Its IUPAC name is 3-amino-N-(2-chlorothiophen-3-yl)-2-methylpropanamide.
| Compound Name | 3-amino-N-(2-chlorothiophen-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 130948894 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-amino-N-(2-chlorothiophen-3-yl)-2-methylpropanamide |
| SMILES | CC(CN)C(=O)Nc1ccsc1Cl |
| InChI | InChI=1S/C8H11ClN2OS/c1-5(4-10)8(12)11-6-2-3-13-7(6)9/h2-3,5H,4,10H2,1H3,(H,11,12) |
| InChIKey | QBOZWZJMQCJJBL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |