About 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole
3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole (PubChem CID 130949274) has the molecular formula C9H8F3NS
and a molecular weight of 219.23 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole |
| PubChem CID | 130949274 |
| Molecular Formula | C9H8F3NS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole |
| SMILES | FC(F)(F)c1ccc(C2=CCNC2)s1 |
| InChI | InChI=1S/C9H8F3NS/c10-9(11,12)8-2-1-7(14-8)6-3-4-13-5-6/h1-3,13H,4-5H2 |
| InChIKey | LYBVPQWWALGAMX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole?
The IUPAC name of 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole (CID 130949274) is 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole is FC(F)(F)c1ccc(C2=CCNC2)s1.
What is the InChIKey of 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole?
The InChIKey is LYBVPQWWALGAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NS/c10-9(11,12)8-2-1-7(14-8)6-3-4-13-5-6/h1-3,13H,4-5H2.
What are the key properties of 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole?
3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole has a molecular weight of 219.23 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(trifluoromethyl)thiophen-2-yl]-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 130949274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).