C9H10INS — CID 130951463
7-iodo-1,2,3,4-tetrahydroquinoline-4-thiol (PubChem CID 130951463) has the molecular formula C9H10INS and a molecular weight of 291.16 g/mol. Its IUPAC name is 7-iodo-1,2,3,4-tetrahydroquinoline-4-thiol.
| Compound Name | 7-iodo-1,2,3,4-tetrahydroquinoline-4-thiol |
|---|---|
| PubChem CID | 130951463 |
| Molecular Formula | C9H10INS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 7-iodo-1,2,3,4-tetrahydroquinoline-4-thiol |
| SMILES | SC1CCNc2cc(I)ccc21 |
| InChI | InChI=1S/C9H10INS/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-2,5,9,11-12H,3-4H2 |
| InChIKey | NUQZQHHUVJEEPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|