C12H20N2 — CID 130951993
N-(1-methylcyclohex-3-en-1-yl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 130951993) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-(1-methylcyclohex-3-en-1-yl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(1-methylcyclohex-3-en-1-yl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 130951993 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-(1-methylcyclohex-3-en-1-yl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CC1(NC2=NCCCC2)CC=CCC1 |
| InChI | InChI=1S/C12H20N2/c1-12(8-4-2-5-9-12)14-11-7-3-6-10-13-11/h2,4H,3,5-10H2,1H3,(H,13,14) |
| InChIKey | UTKFEKMYVYROOI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|