About CID 13095213
CID 13095213 (PubChem CID 13095213) has the molecular formula C10H13N4
and a molecular weight of 189.24 g/mol.
Molecular Properties
| Compound Name | CID 13095213 |
| PubChem CID | 13095213 |
| Molecular Formula | C10H13N4 |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | — |
| SMILES | CN1CN(C)N=C(c2ccccc2)[N]1 |
| InChI | InChI=1S/C10H13N4/c1-13-8-14(2)12-10(11-13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | GRPATPURCZHQCL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 32.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 13095213 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13095213?
The IUPAC name of CID 13095213 (CID 13095213) is not available.
What is the SMILES notation for CID 13095213?
The canonical SMILES for CID 13095213 is CN1CN(C)N=C(c2ccccc2)[N]1.
What is the InChIKey of CID 13095213?
The InChIKey is GRPATPURCZHQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N4/c1-13-8-14(2)12-10(11-13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of CID 13095213?
CID 13095213 has a molecular weight of 189.24 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13095213 is sourced from PubChem (CID 13095213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).