C8H10ClN3 — CID 130955912
3-[(1S)-1-aminoprop-2-enyl]-5-chloropyridin-2-amine (PubChem CID 130955912) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 3-[(1S)-1-aminoprop-2-enyl]-5-chloropyridin-2-amine.
| Compound Name | 3-[(1S)-1-aminoprop-2-enyl]-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 130955912 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3-[(1S)-1-aminoprop-2-enyl]-5-chloropyridin-2-amine |
| SMILES | C=C[C@H](N)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C8H10ClN3/c1-2-7(10)6-3-5(9)4-12-8(6)11/h2-4,7H,1,10H2,(H2,11,12)/t7-/m0/s1 |
| InChIKey | SGYBARJKMQHBGS-ZETCQYMHSA-N |
| XLogP | 1.50 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|