C17H28OSi — CID 13095631
(3aS,6R,7aS)-3,3a-dimethyl-6-prop-1-en-2-yl-2-trimethylsilyl-5,6,7,7a-tetrahydro-1H-inden-4-one (PubChem CID 13095631) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (3aS,6R,7aS)-3,3a-dimethyl-6-prop-1-en-2-yl-2-trimethylsilyl-5,6,7,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (3aS,6R,7aS)-3,3a-dimethyl-6-prop-1-en-2-yl-2-trimethylsilyl-5,6,7,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 13095631 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (3aS,6R,7aS)-3,3a-dimethyl-6-prop-1-en-2-yl-2-trimethylsilyl-5,6,7,7a-tetrahydro-1H-inden-4-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@]2(C)C(C)=C([Si](C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H28OSi/c1-11(2)13-8-14-10-15(19(5,6)7)12(3)17(14,4)16(18)9-13/h13-14H,1,8-10H2,2-7H3/t13-,14+,17-/m1/s1 |
| InChIKey | KSPWKFFSEHRWAI-JKIFEVAISA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|