C12H14BrNO — CID 130958890
(2-bromophenyl)-(3,3-dimethylazetidin-1-yl)methanone (PubChem CID 130958890) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is (2-bromophenyl)-(3,3-dimethylazetidin-1-yl)methanone.
| Compound Name | (2-bromophenyl)-(3,3-dimethylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 130958890 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (2-bromophenyl)-(3,3-dimethylazetidin-1-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccccc2Br)C1 |
| InChI | InChI=1S/C12H14BrNO/c1-12(2)7-14(8-12)11(15)9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3 |
| InChIKey | ZSINWFJHIULSSI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |