C8H16FNO — CID 130961326
N-(2-fluoroethyl)-2,5-dimethyloxolan-3-amine (PubChem CID 130961326) has the molecular formula C8H16FNO and a molecular weight of 161.22 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,5-dimethyloxolan-3-amine.
| Compound Name | N-(2-fluoroethyl)-2,5-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 130961326 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-(2-fluoroethyl)-2,5-dimethyloxolan-3-amine |
| SMILES | CC1CC(NCCF)C(C)O1 |
| InChI | InChI=1S/C8H16FNO/c1-6-5-8(7(2)11-6)10-4-3-9/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | TUYWHSGMFGRGLS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |