About 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine
4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine (PubChem CID 130961363) has the molecular formula C6H6ClN5S
and a molecular weight of 215.67 g/mol. Its IUPAC name is 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine |
| PubChem CID | 130961363 |
| Molecular Formula | C6H6ClN5S |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine |
| SMILES | Nc1nn(Cc2cnsn2)cc1Cl |
| InChI | InChI=1S/C6H6ClN5S/c7-5-3-12(10-6(5)8)2-4-1-9-13-11-4/h1,3H,2H2,(H2,8,10) |
| InChIKey | XCDKDORHKRDJHJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine?
The IUPAC name of 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine (CID 130961363) is 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine.
What is the SMILES notation for 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine?
The canonical SMILES for 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine is Nc1nn(Cc2cnsn2)cc1Cl.
What is the InChIKey of 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine?
The InChIKey is XCDKDORHKRDJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN5S/c7-5-3-12(10-6(5)8)2-4-1-9-13-11-4/h1,3H,2H2,(H2,8,10).
What are the key properties of 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine?
4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine has a molecular weight of 215.67 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(1,2,5-thiadiazol-3-ylmethyl)pyrazol-3-amine is sourced from PubChem (CID 130961363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).