C9H14N4 — CID 130961499
[1-(cyclopenten-1-ylmethyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 130961499) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is [1-(cyclopenten-1-ylmethyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [1-(cyclopenten-1-ylmethyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 130961499 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | [1-(cyclopenten-1-ylmethyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1ncn(CC2=CCCC2)n1 |
| InChI | InChI=1S/C9H14N4/c10-5-9-11-7-13(12-9)6-8-3-1-2-4-8/h3,7H,1-2,4-6,10H2 |
| InChIKey | VJBKVKNKYGECQD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|