About 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole
3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole (PubChem CID 130961608) has the molecular formula C11H17BrN2O
and a molecular weight of 273.17 g/mol. Its IUPAC name is 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole.
Molecular Properties
| Compound Name | 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole |
| PubChem CID | 130961608 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole |
| SMILES | Cn1ccc(CC2COC(C)(C)C2Br)n1 |
| InChI | InChI=1S/C11H17BrN2O/c1-11(2)10(12)8(7-15-11)6-9-4-5-14(3)13-9/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | QTWCMXUNLYQBRR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole?
The IUPAC name of 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole (CID 130961608) is 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole.
What is the SMILES notation for 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole?
The canonical SMILES for 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole is Cn1ccc(CC2COC(C)(C)C2Br)n1.
What is the InChIKey of 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole?
The InChIKey is QTWCMXUNLYQBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2O/c1-11(2)10(12)8(7-15-11)6-9-4-5-14(3)13-9/h4-5,8,10H,6-7H2,1-3H3.
What are the key properties of 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole?
3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole has a molecular weight of 273.17 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-5,5-dimethyloxolan-3-yl)methyl]-1-methylpyrazole is sourced from PubChem (CID 130961608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).